C31H26N2O4S — CID 19301342
N-[(Z)-1-(2-methoxyphenyl)-3-oxo-3-(3-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide (PubChem CID 19301342) has the molecular formula C31H26N2O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is N-[(Z)-1-(2-methoxyphenyl)-3-oxo-3-(3-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2-methoxyphenyl)-3-oxo-3-(3-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301342 |
| Molecular Formula | C31H26N2O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-[(Z)-1-(2-methoxyphenyl)-3-oxo-3-(3-phenacylsulfanylanilino)prop-1-en-2-yl]benzamide |
| SMILES | COc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1cccc(SCC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H26N2O4S/c1-37-29-18-9-8-15-24(29)19-27(33-30(35)23-13-6-3-7-14-23)31(36)32-25-16-10-17-26(20-25)38-21-28(34)22-11-4-2-5-12-22/h2-20H,21H2,1H3,(H,32,36)(H,33,35)/b27-19- |
| InChIKey | IABGALVOHBWMGA-DIBXZPPDSA-N |
| XLogP | 6.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|