C27H26N2O5S — CID 19300518
ethyl 2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate (PubChem CID 19300518) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is ethyl 2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 19300518 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | ethyl 2-[3-[[(E)-2-benzamido-3-(2-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1cccc(NC(=O)/C(=C\c2ccccc2OC)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H26N2O5S/c1-3-34-25(30)18-35-22-14-9-13-21(17-22)28-27(32)23(16-20-12-7-8-15-24(20)33-2)29-26(31)19-10-5-4-6-11-19/h4-17H,3,18H2,1-2H3,(H,28,32)(H,29,31)/b23-16+ |
| InChIKey | BZBNXOYQWWQOTE-XQNSMLJCSA-N |
| XLogP | 4.76 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|