C30H22Cl2FN3O3S — CID 19307152
N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307152) has the molecular formula C30H22Cl2FN3O3S and a molecular weight of 594.50 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307152 |
| Molecular Formula | C30H22Cl2FN3O3S |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2c(Cl)cccc2Cl)NC(=O)c2ccccc2)c1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C30H22Cl2FN3O3S/c31-25-10-5-11-26(32)24(25)17-27(36-29(38)19-6-2-1-3-7-19)30(39)35-22-8-4-9-23(16-22)40-18-28(37)34-21-14-12-20(33)13-15-21/h1-17H,18H2,(H,34,37)(H,35,39)(H,36,38)/b27-17+ |
| InChIKey | HKJXPHVJQZBSFA-WPWMEQJKSA-N |
| XLogP | 7.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|