C30H25FN4O5S2 — CID 19310624
N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19310624) has the molecular formula C30H25FN4O5S2 and a molecular weight of 604.69 g/mol. Its IUPAC name is N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310624 |
| Molecular Formula | C30H25FN4O5S2 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | N-[(Z)-1-(4-fluorophenyl)-3-oxo-3-[3-[2-oxo-2-(4-sulfamoylanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2cccc(NC(=O)/C(=C/c3ccc(F)cc3)NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H25FN4O5S2/c31-22-11-9-20(10-12-22)17-27(35-29(37)21-5-2-1-3-6-21)30(38)34-24-7-4-8-25(18-24)41-19-28(36)33-23-13-15-26(16-14-23)42(32,39)40/h1-18H,19H2,(H,33,36)(H,34,38)(H,35,37)(H2,32,39,40)/b27-17- |
| InChIKey | QSRWFKLGXNNHNT-PKAZHMFMSA-N |
| XLogP | 4.61 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|