C37H27FN4O4S — CID 19310631
N-[(Z)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19310631) has the molecular formula C37H27FN4O4S and a molecular weight of 642.71 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19310631 |
| Molecular Formula | C37H27FN4O4S |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.17 |
| IUPAC Name | N-[(Z)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C/c2ccc(F)cc2)NC(=O)c2ccccc2)c1)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C37H27FN4O4S/c38-27-17-13-24(14-18-27)21-32(41-35(44)25-7-2-1-3-8-25)36(45)40-29-9-6-10-30(22-29)47-23-34(43)39-28-19-15-26(16-20-28)37-42-31-11-4-5-12-33(31)46-37/h1-22H,23H2,(H,39,43)(H,40,45)(H,41,44)/b32-21- |
| InChIKey | WGWXOIGQHITNBC-QXPFVDMISA-N |
| XLogP | 7.77 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|