C37H26Cl2N4O4S — CID 19307175
N-[(E)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307175) has the molecular formula C37H26Cl2N4O4S and a molecular weight of 693.61 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307175 |
| Molecular Formula | C37H26Cl2N4O4S |
| Molecular Weight | 693.61 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | N-[(E)-3-[3-[2-[4-(1,3-benzoxazol-2-yl)anilino]-2-oxoethyl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1cccc(NC(=O)/C(=C\c2c(Cl)cccc2Cl)NC(=O)c2ccccc2)c1)Nc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C37H26Cl2N4O4S/c38-29-12-7-13-30(39)28(29)21-32(42-35(45)23-8-2-1-3-9-23)36(46)41-26-10-6-11-27(20-26)48-22-34(44)40-25-18-16-24(17-19-25)37-43-31-14-4-5-15-33(31)47-37/h1-21H,22H2,(H,40,44)(H,41,46)(H,42,45)/b32-21+ |
| InChIKey | BALJHBYKYSJAEP-RUMWWMSVSA-N |
| XLogP | 8.94 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.61 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|