C40H30N2O3S — CID 19301496
N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19301496) has the molecular formula C40H30N2O3S and a molecular weight of 618.76 g/mol. Its IUPAC name is N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301496 |
| Molecular Formula | C40H30N2O3S |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.20 |
| IUPAC Name | N-[(Z)-1-naphthalen-1-yl-3-oxo-3-[3-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc(-c3ccccc3)cc2)c1)/C(=C/c1cccc2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H30N2O3S/c43-38(31-23-21-29(22-24-31)28-11-3-1-4-12-28)27-46-35-19-10-18-34(26-35)41-40(45)37(42-39(44)32-14-5-2-6-15-32)25-33-17-9-16-30-13-7-8-20-36(30)33/h1-26H,27H2,(H,41,45)(H,42,44)/b37-25- |
| InChIKey | SMUNAPAGIZRWSI-QEOQBAOWSA-N |
| XLogP | 8.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|