C35H25N3O4S — CID 19300715
N-[(Z)-3-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19300715) has the molecular formula C35H25N3O4S and a molecular weight of 583.67 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19300715 |
| Molecular Formula | C35H25N3O4S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | N-[(Z)-3-[3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-1-naphthalen-1-yl-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCN2C(=O)c3ccccc3C2=O)c1)/C(=C/c1cccc2ccccc12)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H25N3O4S/c39-32(24-11-2-1-3-12-24)37-31(20-25-14-8-13-23-10-4-5-17-28(23)25)33(40)36-26-15-9-16-27(21-26)43-22-38-34(41)29-18-6-7-19-30(29)35(38)42/h1-21H,22H2,(H,36,40)(H,37,39)/b31-20- |
| InChIKey | FUMMCFDYEHXBIP-GTWSWNCMSA-N |
| XLogP | 6.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|