C33H27N3O6S — CID 22783973
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783973) has the molecular formula C33H27N3O6S and a molecular weight of 593.66 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783973 |
| Molecular Formula | C33H27N3O6S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCN3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C33H27N3O6S/c1-41-24-14-17-29(42-2)22(18-24)19-28(35-30(37)21-8-4-3-5-9-21)31(38)34-23-12-15-25(16-13-23)43-20-36-32(39)26-10-6-7-11-27(26)33(36)40/h3-19H,20H2,1-2H3,(H,34,38)(H,35,37)/b28-19- |
| InChIKey | FFQMYPFJDWKSDW-USHMODERSA-N |
| XLogP | 5.46 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|