C34H29N3O6S — CID 22783975
N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783975) has the molecular formula C34H29N3O6S and a molecular weight of 607.69 g/mol. Its IUPAC name is N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783975 |
| Molecular Formula | C34H29N3O6S |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | N-[(Z)-1-(2,5-dimethoxyphenyl)-3-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCCN3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C34H29N3O6S/c1-42-25-14-17-30(43-2)23(20-25)21-29(36-31(38)22-8-4-3-5-9-22)32(39)35-24-12-15-26(16-13-24)44-19-18-37-33(40)27-10-6-7-11-28(27)34(37)41/h3-17,20-21H,18-19H2,1-2H3,(H,35,39)(H,36,38)/b29-21- |
| InChIKey | CBDQGQYCYVZQMO-ANYBSYGZSA-N |
| XLogP | 5.50 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|