C26H23N3O4S — CID 22783959
N-[(Z)-3-[4-(cyanomethylsulfanyl)anilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783959) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[(Z)-3-[4-(cyanomethylsulfanyl)anilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-(cyanomethylsulfanyl)anilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783959 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[(Z)-3-[4-(cyanomethylsulfanyl)anilino]-1-(2,5-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC#N)cc2)c1 |
| InChI | InChI=1S/C26H23N3O4S/c1-32-21-10-13-24(33-2)19(16-21)17-23(29-25(30)18-6-4-3-5-7-18)26(31)28-20-8-11-22(12-9-20)34-15-14-27/h3-13,16-17H,15H2,1-2H3,(H,28,31)(H,29,30)/b23-17- |
| InChIKey | GOWJKRNSFVOUJP-QJOMJCCJSA-N |
| XLogP | 4.73 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|