C31H22Cl2F3N3O3S — CID 21385038
N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21385038) has the molecular formula C31H22Cl2F3N3O3S and a molecular weight of 644.50 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21385038 |
| Molecular Formula | C31H22Cl2F3N3O3S |
| Molecular Weight | 644.50 g/mol |
| Exact Mass | 643.07 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-oxo-3-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H22Cl2F3N3O3S/c32-22-10-9-20(26(33)17-22)15-27(39-29(41)19-5-2-1-3-6-19)30(42)38-23-11-13-25(14-12-23)43-18-28(40)37-24-8-4-7-21(16-24)31(34,35)36/h1-17H,18H2,(H,37,40)(H,38,42)(H,39,41)/b27-15- |
| InChIKey | RCCBUZBELNTFIO-DICXZTSXSA-N |
| XLogP | 8.15 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.50 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|