C32H26Cl2N2O4S — CID 22783293
N-[(Z)-1-(2,4-dichlorophenyl)-3-[4-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783293) has the molecular formula C32H26Cl2N2O4S and a molecular weight of 605.54 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dichlorophenyl)-3-[4-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-[4-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783293 |
| Molecular Formula | C32H26Cl2N2O4S |
| Molecular Weight | 605.54 g/mol |
| Exact Mass | 604.10 |
| IUPAC Name | N-[(Z)-1-(2,4-dichlorophenyl)-3-[4-[2-(4-ethoxyphenyl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)CSc2ccc(NC(=O)/C(=C/c3ccc(Cl)cc3Cl)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H26Cl2N2O4S/c1-2-40-26-14-9-21(10-15-26)30(37)20-41-27-16-12-25(13-17-27)35-32(39)29(18-23-8-11-24(33)19-28(23)34)36-31(38)22-6-4-3-5-7-22/h3-19H,2,20H2,1H3,(H,35,39)(H,36,38)/b29-18- |
| InChIKey | NSBNEMIJBAANCN-MIXAMLLLSA-N |
| XLogP | 7.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.54 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|