C31H23N5O5S2 — CID 19713705
N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19713705) has the molecular formula C31H23N5O5S2 and a molecular weight of 609.69 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19713705 |
| Molecular Formula | C31H23N5O5S2 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C31H23N5O5S2/c37-28(35-31-34-24-11-5-7-13-27(24)43-31)19-42-23-16-14-22(15-17-23)32-30(39)25(33-29(38)20-8-2-1-3-9-20)18-21-10-4-6-12-26(21)36(40)41/h1-18H,19H2,(H,32,39)(H,33,38)(H,34,35,37)/b25-18- |
| InChIKey | VRPXZSPCOZFSJE-BWAHOGKJSA-N |
| XLogP | 6.34 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|