C29H22N4O3S3 — CID 19714845
N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide (PubChem CID 19714845) has the molecular formula C29H22N4O3S3 and a molecular weight of 570.72 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19714845 |
| Molecular Formula | C29H22N4O3S3 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | N-[(Z)-3-[4-[2-(1,3-benzothiazol-2-ylamino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-thiophen-3-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C29H22N4O3S3/c34-26(33-29-32-23-8-4-5-9-25(23)39-29)18-38-22-12-10-21(11-13-22)30-28(36)24(16-19-14-15-37-17-19)31-27(35)20-6-2-1-3-7-20/h1-17H,18H2,(H,30,36)(H,31,35)(H,32,33,34)/b24-16- |
| InChIKey | ROMZLVLIJOLBBF-JLPGSUDCSA-N |
| XLogP | 6.50 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|