C33H23Cl2N5O5S2 — CID 22191526
N-[(Z)-3-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191526) has the molecular formula C33H23Cl2N5O5S2 and a molecular weight of 704.62 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191526 |
| Molecular Formula | C33H23Cl2N5O5S2 |
| Molecular Weight | 704.62 g/mol |
| Exact Mass | 703.05 |
| IUPAC Name | N-[(Z)-3-[4-[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)/C(=C/c2ccccc2[N+](=O)[O-])NC(=O)c2ccccc2)cc1)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C33H23Cl2N5O5S2/c34-25-15-10-21(16-26(25)35)28-18-47-33(38-28)39-30(41)19-46-24-13-11-23(12-14-24)36-32(43)27(37-31(42)20-6-2-1-3-7-20)17-22-8-4-5-9-29(22)40(44)45/h1-18H,19H2,(H,36,43)(H,37,42)(H,38,39,41)/b27-17- |
| InChIKey | YXXUOWQDXDLGSV-PKAZHMFMSA-N |
| XLogP | 8.17 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.62 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|