C29H24N2O2S — CID 22784278
N-[(Z)-3-(4-methylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22784278) has the molecular formula C29H24N2O2S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[(Z)-3-(4-methylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-(4-methylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22784278 |
| Molecular Formula | C29H24N2O2S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[(Z)-3-(4-methylsulfanylanilino)-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CSc1ccc(NC(=O)/C(=C/c2ccc(-c3ccccc3)cc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2O2S/c1-34-26-18-16-25(17-19-26)30-29(33)27(31-28(32)24-10-6-3-7-11-24)20-21-12-14-23(15-13-21)22-8-4-2-5-9-22/h2-20H,1H3,(H,30,33)(H,31,32)/b27-20- |
| InChIKey | VHUQFSBCKDCBQT-OOAXWGSJSA-N |
| XLogP | 6.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|