C38H30N4O4 — CID 175665285
1-N,4-N-bis[(E)-3-anilino-3-oxo-1-phenylprop-1-en-2-yl]benzene-1,4-dicarboxamide (PubChem CID 175665285) has the molecular formula C38H30N4O4 and a molecular weight of 606.68 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-3-anilino-3-oxo-1-phenylprop-1-en-2-yl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(E)-3-anilino-3-oxo-1-phenylprop-1-en-2-yl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 175665285 |
| Molecular Formula | C38H30N4O4 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 1-N,4-N-bis[(E)-3-anilino-3-oxo-1-phenylprop-1-en-2-yl]benzene-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccccc1)/C(=C\c1ccccc1)NC(=O)c1ccc(C(=O)N/C(=C/c2ccccc2)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C38H30N4O4/c43-35(41-33(25-27-13-5-1-6-14-27)37(45)39-31-17-9-3-10-18-31)29-21-23-30(24-22-29)36(44)42-34(26-28-15-7-2-8-16-28)38(46)40-32-19-11-4-12-20-32/h1-26H,(H,39,45)(H,40,46)(H,41,43)(H,42,44)/b33-25+,34-26+ |
| InChIKey | ZYPCXGAWGHFNFZ-BCEWYCLDSA-N |
| XLogP | 6.51 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|