C22H16ClFN2O2 — CID 53329743
N-[(Z)-1-(4-chlorophenyl)-3-(4-fluoroanilino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 53329743) has the molecular formula C22H16ClFN2O2 and a molecular weight of 394.83 g/mol. Its IUPAC name is N-[(Z)-1-(4-chlorophenyl)-3-(4-fluoroanilino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(4-chlorophenyl)-3-(4-fluoroanilino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 53329743 |
| Molecular Formula | C22H16ClFN2O2 |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[(Z)-1-(4-chlorophenyl)-3-(4-fluoroanilino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16ClFN2O2/c23-17-8-6-15(7-9-17)14-20(26-21(27)16-4-2-1-3-5-16)22(28)25-19-12-10-18(24)11-13-19/h1-14H,(H,25,28)(H,26,27)/b20-14- |
| InChIKey | CDCFZJYHCAJYKN-ZHZULCJRSA-N |
| XLogP | 4.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|