C31H25ClFN3O3 — CID 155299241
N-[1-(4-chlorophenyl)-3-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]anilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 155299241) has the molecular formula C31H25ClFN3O3 and a molecular weight of 542.01 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]anilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 155299241 |
| Molecular Formula | C31H25ClFN3O3 |
| Molecular Weight | 542.01 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]anilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Cc1ccc(NC(=O)C(=Cc2ccc(Cl)cc2)NC(=O)c2ccccc2)cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H25ClFN3O3/c32-25-12-6-21(7-13-25)18-28(36-30(38)24-4-2-1-3-5-24)31(39)35-27-16-10-22(11-17-27)19-29(37)34-20-23-8-14-26(33)15-9-23/h1-18H,19-20H2,(H,34,37)(H,35,39)(H,36,38) |
| InChIKey | XWVPUNNBFASXLX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.01 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|