C32H28FN3O3 — CID 155299223
N-[(E)-3-[4-[2-(benzylamino)-2-oxoethyl]anilino]-1-(4-fluoro-2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 155299223) has the molecular formula C32H28FN3O3 and a molecular weight of 521.59 g/mol. Its IUPAC name is N-[(E)-3-[4-[2-(benzylamino)-2-oxoethyl]anilino]-1-(4-fluoro-2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[4-[2-(benzylamino)-2-oxoethyl]anilino]-1-(4-fluoro-2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 155299223 |
| Molecular Formula | C32H28FN3O3 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-[(E)-3-[4-[2-(benzylamino)-2-oxoethyl]anilino]-1-(4-fluoro-2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1cc(F)ccc1/C=C(/NC(=O)c1ccccc1)C(=O)Nc1ccc(CC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H28FN3O3/c1-22-18-27(33)15-14-26(22)20-29(36-31(38)25-10-6-3-7-11-25)32(39)35-28-16-12-23(13-17-28)19-30(37)34-21-24-8-4-2-5-9-24/h2-18,20H,19,21H2,1H3,(H,34,37)(H,35,39)(H,36,38)/b29-20+ |
| InChIKey | KFFOIKYFNOHPRP-ZTKZIYFRSA-N |
| XLogP | 5.40 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|