C22H21FN2O — CID 46045383
N-benzyl-2-[4-[(4-fluorophenyl)methylamino]phenyl]acetamide (PubChem CID 46045383) has the molecular formula C22H21FN2O and a molecular weight of 348.42 g/mol. Its IUPAC name is N-benzyl-2-[4-[(4-fluorophenyl)methylamino]phenyl]acetamide.
| Compound Name | N-benzyl-2-[4-[(4-fluorophenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 46045383 |
| Molecular Formula | C22H21FN2O |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-benzyl-2-[4-[(4-fluorophenyl)methylamino]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(NCc2ccc(F)cc2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C22H21FN2O/c23-20-10-6-19(7-11-20)15-24-21-12-8-17(9-13-21)14-22(26)25-16-18-4-2-1-3-5-18/h1-13,24H,14-16H2,(H,25,26) |
| InChIKey | ORVSOYDMHINGSM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |