C18H19FN2O2 — CID 91939014
N-benzyl-N'-[(4-fluorophenyl)methyl]butanediamide (PubChem CID 91939014) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-benzyl-N'-[(4-fluorophenyl)methyl]butanediamide.
| Compound Name | N-benzyl-N'-[(4-fluorophenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 91939014 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-benzyl-N'-[(4-fluorophenyl)methyl]butanediamide |
| SMILES | O=C(CCC(=O)NCc1ccc(F)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C18H19FN2O2/c19-16-8-6-15(7-9-16)13-21-18(23)11-10-17(22)20-12-14-4-2-1-3-5-14/h1-9H,10-13H2,(H,20,22)(H,21,23) |
| InChIKey | LYIRRUNMHPBLIY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |