About N'-benzylbutanediamide
N'-benzylbutanediamide (PubChem CID 4682951) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is N'-benzylbutanediamide.
Molecular Properties
| Compound Name | N'-benzylbutanediamide |
| PubChem CID | 4682951 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N'-benzylbutanediamide |
| SMILES | NC(=O)CCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H14N2O2/c12-10(14)6-7-11(15)13-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,14)(H,13,15) |
| InChIKey | LGJOHQXBMWQPNH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-benzylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzylbutanediamide?
The IUPAC name of N'-benzylbutanediamide (CID 4682951) is N'-benzylbutanediamide.
What is the SMILES notation for N'-benzylbutanediamide?
The canonical SMILES for N'-benzylbutanediamide is NC(=O)CCC(=O)NCc1ccccc1.
What is the InChIKey of N'-benzylbutanediamide?
The InChIKey is LGJOHQXBMWQPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c12-10(14)6-7-11(15)13-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H2,12,14)(H,13,15).
What are the key properties of N'-benzylbutanediamide?
N'-benzylbutanediamide has a molecular weight of 206.25 g/mol, XLogP of 0.57, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzylbutanediamide is sourced from PubChem (CID 4682951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).