About benzene;benzylurea;hydrazine
benzene;benzylurea;hydrazine (PubChem CID 68793593) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is benzene;benzylurea;hydrazine.
Molecular Properties
| Compound Name | benzene;benzylurea;hydrazine |
| PubChem CID | 68793593 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | benzene;benzylurea;hydrazine |
| SMILES | NC(=O)NCc1ccccc1.NN.c1ccccc1 |
| InChI | InChI=1S/C8H10N2O.C6H6.H4N2/c9-8(11)10-6-7-4-2-1-3-5-7;1-2-4-6-5-3-1;1-2/h1-5H,6H2,(H3,9,10,11);1-6H;1-2H2 |
| InChIKey | DHNWQVINBCSDQF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;benzylurea;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;benzylurea;hydrazine?
The IUPAC name of benzene;benzylurea;hydrazine (CID 68793593) is benzene;benzylurea;hydrazine.
What is the SMILES notation for benzene;benzylurea;hydrazine?
The canonical SMILES for benzene;benzylurea;hydrazine is NC(=O)NCc1ccccc1.NN.c1ccccc1.
What is the InChIKey of benzene;benzylurea;hydrazine?
The InChIKey is DHNWQVINBCSDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C6H6.H4N2/c9-8(11)10-6-7-4-2-1-3-5-7;1-2-4-6-5-3-1;1-2/h1-5H,6H2,(H3,9,10,11);1-6H;1-2H2.
What are the key properties of benzene;benzylurea;hydrazine?
benzene;benzylurea;hydrazine has a molecular weight of 260.34 g/mol, XLogP of 1.36, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;benzylurea;hydrazine is sourced from PubChem (CID 68793593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).