About N-benzylacetamide;ethanamine
N-benzylacetamide;ethanamine (PubChem CID 22257034) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-benzylacetamide;ethanamine.
Molecular Properties
| Compound Name | N-benzylacetamide;ethanamine |
| PubChem CID | 22257034 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-benzylacetamide;ethanamine |
| SMILES | CC(=O)NCc1ccccc1.CCN |
| InChI | InChI=1S/C9H11NO.C2H7N/c1-8(11)10-7-9-5-3-2-4-6-9;1-2-3/h2-6H,7H2,1H3,(H,10,11);2-3H2,1H3 |
| InChIKey | SJKVHBFPILIEDE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzylacetamide;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylacetamide;ethanamine?
The IUPAC name of N-benzylacetamide;ethanamine (CID 22257034) is N-benzylacetamide;ethanamine.
What is the SMILES notation for N-benzylacetamide;ethanamine?
The canonical SMILES for N-benzylacetamide;ethanamine is CC(=O)NCc1ccccc1.CCN.
What is the InChIKey of N-benzylacetamide;ethanamine?
The InChIKey is SJKVHBFPILIEDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C2H7N/c1-8(11)10-7-9-5-3-2-4-6-9;1-2-3/h2-6H,7H2,1H3,(H,10,11);2-3H2,1H3.
What are the key properties of N-benzylacetamide;ethanamine?
N-benzylacetamide;ethanamine has a molecular weight of 194.28 g/mol, XLogP of 1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylacetamide;ethanamine is sourced from PubChem (CID 22257034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).