C15H21N3O3 — CID 70538979
N-[[3,5-bis(acetamidomethyl)phenyl]methyl]acetamide (PubChem CID 70538979) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[[3,5-bis(acetamidomethyl)phenyl]methyl]acetamide.
| Compound Name | N-[[3,5-bis(acetamidomethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 70538979 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[[3,5-bis(acetamidomethyl)phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cc(CNC(C)=O)cc(CNC(C)=O)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-10(19)16-7-13-4-14(8-17-11(2)20)6-15(5-13)9-18-12(3)21/h4-6H,7-9H2,1-3H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | RDGXLRKVCMLESU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |