C10H13NOSn — CID 59658577
[3-(acetamidomethyl)phenyl]-methyltin (PubChem CID 59658577) has the molecular formula C10H13NOSn and a molecular weight of 281.93 g/mol. Its IUPAC name is [3-(acetamidomethyl)phenyl]-methyltin.
| Compound Name | [3-(acetamidomethyl)phenyl]-methyltin |
|---|---|
| PubChem CID | 59658577 |
| Molecular Formula | C10H13NOSn |
| Molecular Weight | 281.93 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | [3-(acetamidomethyl)phenyl]-methyltin |
| SMILES | C[Sn]c1cccc(CNC(C)=O)c1 |
| InChI | InChI=1S/C9H10NO.CH3.Sn/c1-8(11)10-7-9-5-3-2-4-6-9;;/h2-3,5-6H,7H2,1H3,(H,10,11);1H3; |
| InChIKey | JUMHANNKMDBZDG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.93 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |