About N-benzylacetamide;toluene
N-benzylacetamide;toluene (PubChem CID 175498463) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is N-benzylacetamide;toluene.
Molecular Properties
| Compound Name | N-benzylacetamide;toluene |
| PubChem CID | 175498463 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-benzylacetamide;toluene |
| SMILES | CC(=O)NCc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C9H11NO.C7H8/c1-8(11)10-7-9-5-3-2-4-6-9;1-7-5-3-2-4-6-7/h2-6H,7H2,1H3,(H,10,11);2-6H,1H3 |
| InChIKey | YPFSZCMDBLESJJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzylacetamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylacetamide;toluene?
The IUPAC name of N-benzylacetamide;toluene (CID 175498463) is N-benzylacetamide;toluene.
What is the SMILES notation for N-benzylacetamide;toluene?
The canonical SMILES for N-benzylacetamide;toluene is CC(=O)NCc1ccccc1.Cc1ccccc1.
What is the InChIKey of N-benzylacetamide;toluene?
The InChIKey is YPFSZCMDBLESJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C7H8/c1-8(11)10-7-9-5-3-2-4-6-9;1-7-5-3-2-4-6-7/h2-6H,7H2,1H3,(H,10,11);2-6H,1H3.
What are the key properties of N-benzylacetamide;toluene?
N-benzylacetamide;toluene has a molecular weight of 241.33 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylacetamide;toluene is sourced from PubChem (CID 175498463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).