About 2-acetamidoacetamide;ethane;toluene
2-acetamidoacetamide;ethane;toluene (PubChem CID 145152417) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-acetamidoacetamide;ethane;toluene.
Molecular Properties
| Compound Name | 2-acetamidoacetamide;ethane;toluene |
| PubChem CID | 145152417 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-acetamidoacetamide;ethane;toluene |
| SMILES | CC.CC(=O)NCC(N)=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C4H8N2O2.C2H6/c1-7-5-3-2-4-6-7;1-3(7)6-2-4(5)8;1-2/h2-6H,1H3;2H2,1H3,(H2,5,8)(H,6,7);1-2H3 |
| InChIKey | LLLKVHPICTYPFI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetamidoacetamide;ethane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoacetamide;ethane;toluene?
The IUPAC name of 2-acetamidoacetamide;ethane;toluene (CID 145152417) is 2-acetamidoacetamide;ethane;toluene.
What is the SMILES notation for 2-acetamidoacetamide;ethane;toluene?
The canonical SMILES for 2-acetamidoacetamide;ethane;toluene is CC.CC(=O)NCC(N)=O.Cc1ccccc1.
What is the InChIKey of 2-acetamidoacetamide;ethane;toluene?
The InChIKey is LLLKVHPICTYPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C4H8N2O2.C2H6/c1-7-5-3-2-4-6-7;1-3(7)6-2-4(5)8;1-2/h2-6H,1H3;2H2,1H3,(H2,5,8)(H,6,7);1-2H3.
What are the key properties of 2-acetamidoacetamide;ethane;toluene?
2-acetamidoacetamide;ethane;toluene has a molecular weight of 238.33 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoacetamide;ethane;toluene is sourced from PubChem (CID 145152417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).