About acetic acid;guanidine;toluene
acetic acid;guanidine;toluene (PubChem CID 160673337) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is acetic acid;guanidine;toluene.
Molecular Properties
| Compound Name | acetic acid;guanidine;toluene |
| PubChem CID | 160673337 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | acetic acid;guanidine;toluene |
| SMILES | CC(=O)O.Cc1ccccc1.[H]N=C(N)N |
| InChI | InChI=1S/C7H8.C2H4O2.CH5N3/c1-7-5-3-2-4-6-7;1-2(3)4;2-1(3)4/h2-6H,1H3;1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | ZZZSNIXYVUJLFZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;guanidine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;guanidine;toluene?
The IUPAC name of acetic acid;guanidine;toluene (CID 160673337) is acetic acid;guanidine;toluene.
What is the SMILES notation for acetic acid;guanidine;toluene?
The canonical SMILES for acetic acid;guanidine;toluene is CC(=O)O.Cc1ccccc1.[H]N=C(N)N.
What is the InChIKey of acetic acid;guanidine;toluene?
The InChIKey is ZZZSNIXYVUJLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C2H4O2.CH5N3/c1-7-5-3-2-4-6-7;1-2(3)4;2-1(3)4/h2-6H,1H3;1H3,(H,3,4);(H5,2,3,4).
What are the key properties of acetic acid;guanidine;toluene?
acetic acid;guanidine;toluene has a molecular weight of 211.26 g/mol, XLogP of 0.92, 0 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;guanidine;toluene is sourced from PubChem (CID 160673337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).