About acetic acid;benzylsulfanylmethylbenzene;guanidine
acetic acid;benzylsulfanylmethylbenzene;guanidine (PubChem CID 174558174) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is acetic acid;benzylsulfanylmethylbenzene;guanidine.
Molecular Properties
| Compound Name | acetic acid;benzylsulfanylmethylbenzene;guanidine |
| PubChem CID | 174558174 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | acetic acid;benzylsulfanylmethylbenzene;guanidine |
| SMILES | CC(=O)O.[H]N=C(N)N.c1ccc(CSCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14S.C2H4O2.CH5N3/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-2(3)4;2-1(3)4/h1-10H,11-12H2;1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | FNLPRHBTGWVANK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;benzylsulfanylmethylbenzene;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;benzylsulfanylmethylbenzene;guanidine?
The IUPAC name of acetic acid;benzylsulfanylmethylbenzene;guanidine (CID 174558174) is acetic acid;benzylsulfanylmethylbenzene;guanidine.
What is the SMILES notation for acetic acid;benzylsulfanylmethylbenzene;guanidine?
The canonical SMILES for acetic acid;benzylsulfanylmethylbenzene;guanidine is CC(=O)O.[H]N=C(N)N.c1ccc(CSCc2ccccc2)cc1.
What is the InChIKey of acetic acid;benzylsulfanylmethylbenzene;guanidine?
The InChIKey is FNLPRHBTGWVANK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S.C2H4O2.CH5N3/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-2(3)4;2-1(3)4/h1-10H,11-12H2;1H3,(H,3,4);(H5,2,3,4).
What are the key properties of acetic acid;benzylsulfanylmethylbenzene;guanidine?
acetic acid;benzylsulfanylmethylbenzene;guanidine has a molecular weight of 333.46 g/mol, XLogP of 3.05, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;benzylsulfanylmethylbenzene;guanidine is sourced from PubChem (CID 174558174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).