C26H24S — CID 66703910
benzylsulfanylmethylbenzene;1,1'-biphenyl (PubChem CID 66703910) has the molecular formula C26H24S and a molecular weight of 368.55 g/mol. Its IUPAC name is benzylsulfanylmethylbenzene;1,1'-biphenyl.
| Compound Name | benzylsulfanylmethylbenzene;1,1'-biphenyl |
|---|---|
| PubChem CID | 66703910 |
| Molecular Formula | C26H24S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | benzylsulfanylmethylbenzene;1,1'-biphenyl |
| SMILES | c1ccc(-c2ccccc2)cc1.c1ccc(CSCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14S.C12H10/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H,11-12H2;1-10H |
| InChIKey | MIVZQXRWVPOLBE-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |