C22H21ClPdS2 — CID 10951084
1,3-bis(benzylsulfanylmethyl)benzene-2-ide;chloropalladium(1+) (PubChem CID 10951084) has the molecular formula C22H21ClPdS2 and a molecular weight of 491.42 g/mol. Its IUPAC name is 1,3-bis(benzylsulfanylmethyl)benzene-2-ide;chloropalladium(1+).
| Compound Name | 1,3-bis(benzylsulfanylmethyl)benzene-2-ide;chloropalladium(1+) |
|---|---|
| PubChem CID | 10951084 |
| Molecular Formula | C22H21ClPdS2 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 1,3-bis(benzylsulfanylmethyl)benzene-2-ide;chloropalladium(1+) |
| SMILES | Cl[Pd+].[c-]1c(CSCc2ccccc2)cccc1CSCc1ccccc1 |
| InChI | InChI=1S/C22H21S2.ClH.Pd/c1-3-8-19(9-4-1)15-23-17-21-12-7-13-22(14-21)18-24-16-20-10-5-2-6-11-20;;/h1-13H,15-18H2;1H;/q-1;;+2/p-1 |
| InChIKey | LAMIVVHPJWJLAJ-UHFFFAOYSA-M |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|