About benzylsulfanylmethylbenzene;iodopalladium(1+)
benzylsulfanylmethylbenzene;iodopalladium(1+) (PubChem CID 15967544) has the molecular formula C14H13IPdS
and a molecular weight of 446.65 g/mol. Its IUPAC name is benzylsulfanylmethylbenzene;iodopalladium(1+).
Molecular Properties
| Compound Name | benzylsulfanylmethylbenzene;iodopalladium(1+) |
| PubChem CID | 15967544 |
| Molecular Formula | C14H13IPdS |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 445.88 |
| IUPAC Name | benzylsulfanylmethylbenzene;iodopalladium(1+) |
| SMILES | [Pd+]I.[c-]1cccc(CSCc2ccccc2)c1 |
| InChI | InChI=1S/C14H13S.HI.Pd/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;/h1-5,7-10H,11-12H2;1H;/q-1;;+2/p-1 |
| InChIKey | ZBQWSNLOLOMBNX-UHFFFAOYSA-M |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzylsulfanylmethylbenzene;iodopalladium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanylmethylbenzene;iodopalladium(1+)?
The IUPAC name of benzylsulfanylmethylbenzene;iodopalladium(1+) (CID 15967544) is benzylsulfanylmethylbenzene;iodopalladium(1+).
What is the SMILES notation for benzylsulfanylmethylbenzene;iodopalladium(1+)?
The canonical SMILES for benzylsulfanylmethylbenzene;iodopalladium(1+) is [Pd+]I.[c-]1cccc(CSCc2ccccc2)c1.
What is the InChIKey of benzylsulfanylmethylbenzene;iodopalladium(1+)?
The InChIKey is ZBQWSNLOLOMBNX-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H13S.HI.Pd/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;/h1-5,7-10H,11-12H2;1H;/q-1;;+2/p-1.
What are the key properties of benzylsulfanylmethylbenzene;iodopalladium(1+)?
benzylsulfanylmethylbenzene;iodopalladium(1+) has a molecular weight of 446.65 g/mol, XLogP of 4.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanylmethylbenzene;iodopalladium(1+) is sourced from PubChem (CID 15967544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).