About dizinc;2-phenylethylbenzene;propane
dizinc;2-phenylethylbenzene;propane (PubChem CID 177427597) has the molecular formula C20H26Zn2
and a molecular weight of 397.21 g/mol. Its IUPAC name is dizinc;2-phenylethylbenzene;propane.
Molecular Properties
| Compound Name | dizinc;2-phenylethylbenzene;propane |
| PubChem CID | 177427597 |
| Molecular Formula | C20H26Zn2 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | dizinc;2-phenylethylbenzene;propane |
| SMILES | C[CH-]C.C[CH-]C.[Zn+2].[Zn+2].[c-]1cccc(CCc2c[c-]ccc2)c1 |
| InChI | InChI=1S/C14H12.2C3H7.2Zn/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-3-2;;/h1-3,5,7-10H,11-12H2;2*3H,1-2H3;;/q-2;2*-1;2*+2 |
| InChIKey | PRECOOYDWLQFCV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dizinc;2-phenylethylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dizinc;2-phenylethylbenzene;propane?
The IUPAC name of dizinc;2-phenylethylbenzene;propane (CID 177427597) is dizinc;2-phenylethylbenzene;propane.
What is the SMILES notation for dizinc;2-phenylethylbenzene;propane?
The canonical SMILES for dizinc;2-phenylethylbenzene;propane is C[CH-]C.C[CH-]C.[Zn+2].[Zn+2].[c-]1cccc(CCc2c[c-]ccc2)c1.
What is the InChIKey of dizinc;2-phenylethylbenzene;propane?
The InChIKey is PRECOOYDWLQFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.2C3H7.2Zn/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-3-2;;/h1-3,5,7-10H,11-12H2;2*3H,1-2H3;;/q-2;2*-1;2*+2.
What are the key properties of dizinc;2-phenylethylbenzene;propane?
dizinc;2-phenylethylbenzene;propane has a molecular weight of 397.21 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dizinc;2-phenylethylbenzene;propane is sourced from PubChem (CID 177427597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).