About magnesium;pentoxymethylbenzene;bromide
magnesium;pentoxymethylbenzene;bromide (PubChem CID 91655374) has the molecular formula C12H17BrMgO
and a molecular weight of 281.48 g/mol. Its IUPAC name is magnesium;pentoxymethylbenzene;bromide.
Molecular Properties
| Compound Name | magnesium;pentoxymethylbenzene;bromide |
| PubChem CID | 91655374 |
| Molecular Formula | C12H17BrMgO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | magnesium;pentoxymethylbenzene;bromide |
| SMILES | CCCCCOCc1c[c-]ccc1.[Br-].[Mg+2] |
| InChI | InChI=1S/C12H17O.BrH.Mg/c1-2-3-7-10-13-11-12-8-5-4-6-9-12;;/h4-5,8-9H,2-3,7,10-11H2,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | JOTXBIBYPNKHJR-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;pentoxymethylbenzene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;pentoxymethylbenzene;bromide?
The IUPAC name of magnesium;pentoxymethylbenzene;bromide (CID 91655374) is magnesium;pentoxymethylbenzene;bromide.
What is the SMILES notation for magnesium;pentoxymethylbenzene;bromide?
The canonical SMILES for magnesium;pentoxymethylbenzene;bromide is CCCCCOCc1c[c-]ccc1.[Br-].[Mg+2].
What is the InChIKey of magnesium;pentoxymethylbenzene;bromide?
The InChIKey is JOTXBIBYPNKHJR-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H17O.BrH.Mg/c1-2-3-7-10-13-11-12-8-5-4-6-9-12;;/h4-5,8-9H,2-3,7,10-11H2,1H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;pentoxymethylbenzene;bromide?
magnesium;pentoxymethylbenzene;bromide has a molecular weight of 281.48 g/mol, XLogP of -0.18, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;pentoxymethylbenzene;bromide is sourced from PubChem (CID 91655374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).