About bromopalladium(1+);2-phenylethanamine;triphenylphosphane
bromopalladium(1+);2-phenylethanamine;triphenylphosphane (PubChem CID 15973318) has the molecular formula C26H25BrNPPd
and a molecular weight of 568.79 g/mol. Its IUPAC name is bromopalladium(1+);2-phenylethanamine;triphenylphosphane.
Molecular Properties
| Compound Name | bromopalladium(1+);2-phenylethanamine;triphenylphosphane |
| PubChem CID | 15973318 |
| Molecular Formula | C26H25BrNPPd |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 566.99 |
| IUPAC Name | bromopalladium(1+);2-phenylethanamine;triphenylphosphane |
| SMILES | Br[Pd+].NCCc1c[c-]ccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C8H10N.BrH.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-7-6-8-4-2-1-3-5-8;;/h1-15H;1-2,4-5H,6-7,9H2;1H;/q;-1;;+2/p-1 |
| InChIKey | CJJMORPJCNJLHM-UHFFFAOYSA-M |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromopalladium(1+);2-phenylethanamine;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromopalladium(1+);2-phenylethanamine;triphenylphosphane?
The IUPAC name of bromopalladium(1+);2-phenylethanamine;triphenylphosphane (CID 15973318) is bromopalladium(1+);2-phenylethanamine;triphenylphosphane.
What is the SMILES notation for bromopalladium(1+);2-phenylethanamine;triphenylphosphane?
The canonical SMILES for bromopalladium(1+);2-phenylethanamine;triphenylphosphane is Br[Pd+].NCCc1c[c-]ccc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bromopalladium(1+);2-phenylethanamine;triphenylphosphane?
The InChIKey is CJJMORPJCNJLHM-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.C8H10N.BrH.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;9-7-6-8-4-2-1-3-5-8;;/h1-15H;1-2,4-5H,6-7,9H2;1H;/q;-1;;+2/p-1.
What are the key properties of bromopalladium(1+);2-phenylethanamine;triphenylphosphane?
bromopalladium(1+);2-phenylethanamine;triphenylphosphane has a molecular weight of 568.79 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromopalladium(1+);2-phenylethanamine;triphenylphosphane is sourced from PubChem (CID 15973318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).