About perchloric acid;2-phenylethanamine
perchloric acid;2-phenylethanamine (PubChem CID 71364418) has the molecular formula C8H12ClNO4
and a molecular weight of 221.64 g/mol. Its IUPAC name is perchloric acid;2-phenylethanamine.
Molecular Properties
| Compound Name | perchloric acid;2-phenylethanamine |
| PubChem CID | 71364418 |
| Molecular Formula | C8H12ClNO4 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | perchloric acid;2-phenylethanamine |
| SMILES | NCCc1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C8H11N.ClHO4/c9-7-6-8-4-2-1-3-5-8;2-1(3,4)5/h1-5H,6-7,9H2;(H,2,3,4,5) |
| InChIKey | UWVTVXVAMVDPNF-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze perchloric acid;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perchloric acid;2-phenylethanamine?
The IUPAC name of perchloric acid;2-phenylethanamine (CID 71364418) is perchloric acid;2-phenylethanamine.
What is the SMILES notation for perchloric acid;2-phenylethanamine?
The canonical SMILES for perchloric acid;2-phenylethanamine is NCCc1ccccc1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of perchloric acid;2-phenylethanamine?
The InChIKey is UWVTVXVAMVDPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.ClHO4/c9-7-6-8-4-2-1-3-5-8;2-1(3,4)5/h1-5H,6-7,9H2;(H,2,3,4,5).
What are the key properties of perchloric acid;2-phenylethanamine?
perchloric acid;2-phenylethanamine has a molecular weight of 221.64 g/mol, XLogP of -2.94, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for perchloric acid;2-phenylethanamine is sourced from PubChem (CID 71364418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).