About benzene;2-phenylethylbenzene
benzene;2-phenylethylbenzene (PubChem CID 18982764) has the molecular formula C20H20
and a molecular weight of 260.38 g/mol. Its IUPAC name is benzene;2-phenylethylbenzene.
Molecular Properties
| Compound Name | benzene;2-phenylethylbenzene |
| PubChem CID | 18982764 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | benzene;2-phenylethylbenzene |
| SMILES | c1ccc(CCc2ccccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C14H14.C6H6/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-4-6-5-3-1/h1-10H,11-12H2;1-6H |
| InChIKey | BGFKWWFYNIHZCA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-phenylethylbenzene?
The IUPAC name of benzene;2-phenylethylbenzene (CID 18982764) is benzene;2-phenylethylbenzene.
What is the SMILES notation for benzene;2-phenylethylbenzene?
The canonical SMILES for benzene;2-phenylethylbenzene is c1ccc(CCc2ccccc2)cc1.c1ccccc1.
What is the InChIKey of benzene;2-phenylethylbenzene?
The InChIKey is BGFKWWFYNIHZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C6H6/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-4-6-5-3-1/h1-10H,11-12H2;1-6H.
What are the key properties of benzene;2-phenylethylbenzene?
benzene;2-phenylethylbenzene has a molecular weight of 260.38 g/mol, XLogP of 5.16, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-phenylethylbenzene is sourced from PubChem (CID 18982764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).