About ethane;methane;2-phenylethylbenzene
ethane;methane;2-phenylethylbenzene (PubChem CID 158652330) has the molecular formula C20H34
and a molecular weight of 274.49 g/mol. Its IUPAC name is ethane;methane;2-phenylethylbenzene.
Molecular Properties
| Compound Name | ethane;methane;2-phenylethylbenzene |
| PubChem CID | 158652330 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | ethane;methane;2-phenylethylbenzene |
| SMILES | C.C.CC.CC.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.2C2H6.2CH4/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2;;/h1-10H,11-12H2;2*1-2H3;2*1H4 |
| InChIKey | IBRZWHFKXCMVLA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;2-phenylethylbenzene?
The IUPAC name of ethane;methane;2-phenylethylbenzene (CID 158652330) is ethane;methane;2-phenylethylbenzene.
What is the SMILES notation for ethane;methane;2-phenylethylbenzene?
The canonical SMILES for ethane;methane;2-phenylethylbenzene is C.C.CC.CC.c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of ethane;methane;2-phenylethylbenzene?
The InChIKey is IBRZWHFKXCMVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.2C2H6.2CH4/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;2*1-2;;/h1-10H,11-12H2;2*1-2H3;2*1H4.
What are the key properties of ethane;methane;2-phenylethylbenzene?
ethane;methane;2-phenylethylbenzene has a molecular weight of 274.49 g/mol, XLogP of 6.80, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;2-phenylethylbenzene is sourced from PubChem (CID 158652330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).