About hafnium;2-phenylethylbenzene
hafnium;2-phenylethylbenzene (PubChem CID 173109801) has the molecular formula C14H14Hf
and a molecular weight of 360.76 g/mol. Its IUPAC name is hafnium;2-phenylethylbenzene.
Molecular Properties
| Compound Name | hafnium;2-phenylethylbenzene |
| PubChem CID | 173109801 |
| Molecular Formula | C14H14Hf |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | hafnium;2-phenylethylbenzene |
| SMILES | [Hf].c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.Hf/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;/h1-10H,11-12H2; |
| InChIKey | JGEOYXVJJOIJAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hafnium;2-phenylethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;2-phenylethylbenzene?
The IUPAC name of hafnium;2-phenylethylbenzene (CID 173109801) is hafnium;2-phenylethylbenzene.
What is the SMILES notation for hafnium;2-phenylethylbenzene?
The canonical SMILES for hafnium;2-phenylethylbenzene is [Hf].c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of hafnium;2-phenylethylbenzene?
The InChIKey is JGEOYXVJJOIJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.Hf/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;/h1-10H,11-12H2;.
What are the key properties of hafnium;2-phenylethylbenzene?
hafnium;2-phenylethylbenzene has a molecular weight of 360.76 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;2-phenylethylbenzene is sourced from PubChem (CID 173109801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).