About methane;4-phenylbutylbenzene
methane;4-phenylbutylbenzene (PubChem CID 173386802) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is methane;4-phenylbutylbenzene.
Molecular Properties
| Compound Name | methane;4-phenylbutylbenzene |
| PubChem CID | 173386802 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | methane;4-phenylbutylbenzene |
| SMILES | C.c1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18.CH4/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;/h1-6,9-12H,7-8,13-14H2;1H4 |
| InChIKey | VMFKWUYAEOMILI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;4-phenylbutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-phenylbutylbenzene?
The IUPAC name of methane;4-phenylbutylbenzene (CID 173386802) is methane;4-phenylbutylbenzene.
What is the SMILES notation for methane;4-phenylbutylbenzene?
The canonical SMILES for methane;4-phenylbutylbenzene is C.c1ccc(CCCCc2ccccc2)cc1.
What is the InChIKey of methane;4-phenylbutylbenzene?
The InChIKey is VMFKWUYAEOMILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.CH4/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16;/h1-6,9-12H,7-8,13-14H2;1H4.
What are the key properties of methane;4-phenylbutylbenzene?
methane;4-phenylbutylbenzene has a molecular weight of 226.36 g/mol, XLogP of 4.89, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-phenylbutylbenzene is sourced from PubChem (CID 173386802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).