About CID 159131095
CID 159131095 (PubChem CID 159131095) has the molecular formula C15H16B
and a molecular weight of 207.11 g/mol.
Molecular Properties
| Compound Name | CID 159131095 |
| PubChem CID | 159131095 |
| Molecular Formula | C15H16B |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | — |
| SMILES | [B].c1ccc(CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H16.B/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;/h1-6,8-11H,7,12-13H2; |
| InChIKey | VMGULFNZZQQBEL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159131095 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159131095?
The IUPAC name of CID 159131095 (CID 159131095) is not available.
What is the SMILES notation for CID 159131095?
The canonical SMILES for CID 159131095 is [B].c1ccc(CCCc2ccccc2)cc1.
What is the InChIKey of CID 159131095?
The InChIKey is VMGULFNZZQQBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.B/c1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;/h1-6,8-11H,7,12-13H2;.
What are the key properties of CID 159131095?
CID 159131095 has a molecular weight of 207.11 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159131095 is sourced from PubChem (CID 159131095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).