About zinc butylbenzene
zinc butylbenzene (PubChem CID 563257) has the molecular formula C20H26Zn
and a molecular weight of 331.82 g/mol. Its IUPAC name is zinc butylbenzene.
Molecular Properties
| Compound Name | zinc butylbenzene |
| PubChem CID | 563257 |
| Molecular Formula | C20H26Zn |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | zinc butylbenzene |
| SMILES | [CH2-]CCCc1ccccc1.[CH2-]CCCc1ccccc1.[Zn+2] |
| InChI | InChI=1S/2C10H13.Zn/c2*1-2-3-7-10-8-5-4-6-9-10;/h2*4-6,8-9H,1-3,7H2;/q2*-1;+2 |
| InChIKey | RQKXOSKZRIKVHS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc butylbenzene?
The IUPAC name of zinc butylbenzene (CID 563257) is zinc butylbenzene.
What is the SMILES notation for zinc butylbenzene?
The canonical SMILES for zinc butylbenzene is [CH2-]CCCc1ccccc1.[CH2-]CCCc1ccccc1.[Zn+2].
What is the InChIKey of zinc butylbenzene?
The InChIKey is RQKXOSKZRIKVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H13.Zn/c2*1-2-3-7-10-8-5-4-6-9-10;/h2*4-6,8-9H,1-3,7H2;/q2*-1;+2.
What are the key properties of zinc butylbenzene?
zinc butylbenzene has a molecular weight of 331.82 g/mol, XLogP of 5.68, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc butylbenzene is sourced from PubChem (CID 563257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).