About alumane;2-phenylethylbenzene;hydrobromide
alumane;2-phenylethylbenzene;hydrobromide (PubChem CID 173446278) has the molecular formula C14H18AlBr
and a molecular weight of 293.18 g/mol. Its IUPAC name is alumane;2-phenylethylbenzene;hydrobromide.
Molecular Properties
| Compound Name | alumane;2-phenylethylbenzene;hydrobromide |
| PubChem CID | 173446278 |
| Molecular Formula | C14H18AlBr |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | alumane;2-phenylethylbenzene;hydrobromide |
| SMILES | Br.[AlH3].c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.Al.BrH.3H/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;;;;/h1-10H,11-12H2;;1H;;; |
| InChIKey | PGAATYYUELGJNB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze alumane;2-phenylethylbenzene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2-phenylethylbenzene;hydrobromide?
The IUPAC name of alumane;2-phenylethylbenzene;hydrobromide (CID 173446278) is alumane;2-phenylethylbenzene;hydrobromide.
What is the SMILES notation for alumane;2-phenylethylbenzene;hydrobromide?
The canonical SMILES for alumane;2-phenylethylbenzene;hydrobromide is Br.[AlH3].c1ccc(CCc2ccccc2)cc1.
What is the InChIKey of alumane;2-phenylethylbenzene;hydrobromide?
The InChIKey is PGAATYYUELGJNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.Al.BrH.3H/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;;;;;/h1-10H,11-12H2;;1H;;;.
What are the key properties of alumane;2-phenylethylbenzene;hydrobromide?
alumane;2-phenylethylbenzene;hydrobromide has a molecular weight of 293.18 g/mol, XLogP of 2.87, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2-phenylethylbenzene;hydrobromide is sourced from PubChem (CID 173446278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).