About acetic acid;pentakis(guanidine)
acetic acid;pentakis(guanidine) (PubChem CID 174792068) has the molecular formula C7H29N15O2
and a molecular weight of 355.41 g/mol. Its IUPAC name is acetic acid;pentakis(guanidine).
Molecular Properties
| Compound Name | acetic acid;pentakis(guanidine) |
| PubChem CID | 174792068 |
| Molecular Formula | C7H29N15O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | acetic acid;pentakis(guanidine) |
| SMILES | CC(=O)O.[H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N |
| InChI | InChI=1S/C2H4O2.5CH5N3/c1-2(3)4;5*2-1(3)4/h1H3,(H,3,4);5*(H5,2,3,4) |
| InChIKey | UYIHHMXICVFBED-UHFFFAOYSA-N |
| XLogP | -5.72 |
| TPSA | 416.75 Ų |
| H-Bond Donors | 16 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | -5.72 |
| H-Bond Donors ≤ 5 | 16 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;pentakis(guanidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;pentakis(guanidine)?
The IUPAC name of acetic acid;pentakis(guanidine) (CID 174792068) is acetic acid;pentakis(guanidine).
What is the SMILES notation for acetic acid;pentakis(guanidine)?
The canonical SMILES for acetic acid;pentakis(guanidine) is CC(=O)O.[H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N.[H]N=C(N)N.
What is the InChIKey of acetic acid;pentakis(guanidine)?
The InChIKey is UYIHHMXICVFBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.5CH5N3/c1-2(3)4;5*2-1(3)4/h1H3,(H,3,4);5*(H5,2,3,4).
What are the key properties of acetic acid;pentakis(guanidine)?
acetic acid;pentakis(guanidine) has a molecular weight of 355.41 g/mol, XLogP of -5.72, 0 rotatable bonds, 16 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;pentakis(guanidine) is sourced from PubChem (CID 174792068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).