About acetic acid;methanediamine
acetic acid;methanediamine (PubChem CID 162329452) has the molecular formula C3H10N2O2
and a molecular weight of 106.12 g/mol. Its IUPAC name is acetic acid;methanediamine.
Molecular Properties
| Compound Name | acetic acid;methanediamine |
| PubChem CID | 162329452 |
| Molecular Formula | C3H10N2O2 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.07 |
| IUPAC Name | acetic acid;methanediamine |
| SMILES | CC(=O)O.NCN |
| InChI | InChI=1S/C2H4O2.CH6N2/c1-2(3)4;2-1-3/h1H3,(H,3,4);1-3H2 |
| InChIKey | QYCSXDUTDLMDGY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;methanediamine?
The IUPAC name of acetic acid;methanediamine (CID 162329452) is acetic acid;methanediamine.
What is the SMILES notation for acetic acid;methanediamine?
The canonical SMILES for acetic acid;methanediamine is CC(=O)O.NCN.
What is the InChIKey of acetic acid;methanediamine?
The InChIKey is QYCSXDUTDLMDGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.CH6N2/c1-2(3)4;2-1-3/h1H3,(H,3,4);1-3H2.
What are the key properties of acetic acid;methanediamine?
acetic acid;methanediamine has a molecular weight of 106.12 g/mol, XLogP of -1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;methanediamine is sourced from PubChem (CID 162329452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).