acetic acid;2-aminoacetic acid;azane

C4H12N2O4 — CID 175048501

IUPACacetic acid;2-aminoacetic acid;azane
SMILESCC(=O)O.N.NCC(=O)O
InChIInChI=1S/C2H5NO2.C2H4O2.H3N/c3-1-2(4)5;1-2(3)4;/h1,3H2,(H,4,5);1H3,(H,3,4);1H3
InChIKeyXMOKABWFKXWZMA-UHFFFAOYSA-N
MW152.15 g/mol
LogP-0.72
Rot. Bonds1

About acetic acid;2-aminoacetic acid;azane

acetic acid;2-aminoacetic acid;azane (PubChem CID 175048501) has the molecular formula C4H12N2O4 and a molecular weight of 152.15 g/mol. Its IUPAC name is acetic acid;2-aminoacetic acid;azane.

Molecular Properties

Compound Nameacetic acid;2-aminoacetic acid;azane
PubChem CID175048501
Molecular FormulaC4H12N2O4
Molecular Weight152.15 g/mol
Exact Mass152.08
IUPAC Nameacetic acid;2-aminoacetic acid;azane
SMILESCC(=O)O.N.NCC(=O)O
InChIInChI=1S/C2H5NO2.C2H4O2.H3N/c3-1-2(4)5;1-2(3)4;/h1,3H2,(H,4,5);1H3,(H,3,4);1H3
InChIKeyXMOKABWFKXWZMA-UHFFFAOYSA-N
XLogP-0.72
TPSA135.62 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.15
LogP ≤ 5-0.72
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze acetic acid;2-aminoacetic acid;azane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-aminoacetic acid;azane?
The IUPAC name of acetic acid;2-aminoacetic acid;azane (CID 175048501) is acetic acid;2-aminoacetic acid;azane.
What is the SMILES notation for acetic acid;2-aminoacetic acid;azane?
The canonical SMILES for acetic acid;2-aminoacetic acid;azane is CC(=O)O.N.NCC(=O)O.
What is the InChIKey of acetic acid;2-aminoacetic acid;azane?
The InChIKey is XMOKABWFKXWZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H4O2.H3N/c3-1-2(4)5;1-2(3)4;/h1,3H2,(H,4,5);1H3,(H,3,4);1H3.
What are the key properties of acetic acid;2-aminoacetic acid;azane?
acetic acid;2-aminoacetic acid;azane has a molecular weight of 152.15 g/mol, XLogP of -0.72, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-aminoacetic acid;azane is sourced from PubChem (CID 175048501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).