About acetic acid;2-aminoacetic acid;azane
acetic acid;2-aminoacetic acid;azane (PubChem CID 175048501) has the molecular formula C4H12N2O4
and a molecular weight of 152.15 g/mol. Its IUPAC name is acetic acid;2-aminoacetic acid;azane.
Molecular Properties
| Compound Name | acetic acid;2-aminoacetic acid;azane |
| PubChem CID | 175048501 |
| Molecular Formula | C4H12N2O4 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | acetic acid;2-aminoacetic acid;azane |
| SMILES | CC(=O)O.N.NCC(=O)O |
| InChI | InChI=1S/C2H5NO2.C2H4O2.H3N/c3-1-2(4)5;1-2(3)4;/h1,3H2,(H,4,5);1H3,(H,3,4);1H3 |
| InChIKey | XMOKABWFKXWZMA-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;2-aminoacetic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-aminoacetic acid;azane?
The IUPAC name of acetic acid;2-aminoacetic acid;azane (CID 175048501) is acetic acid;2-aminoacetic acid;azane.
What is the SMILES notation for acetic acid;2-aminoacetic acid;azane?
The canonical SMILES for acetic acid;2-aminoacetic acid;azane is CC(=O)O.N.NCC(=O)O.
What is the InChIKey of acetic acid;2-aminoacetic acid;azane?
The InChIKey is XMOKABWFKXWZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H4O2.H3N/c3-1-2(4)5;1-2(3)4;/h1,3H2,(H,4,5);1H3,(H,3,4);1H3.
What are the key properties of acetic acid;2-aminoacetic acid;azane?
acetic acid;2-aminoacetic acid;azane has a molecular weight of 152.15 g/mol, XLogP of -0.72, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-aminoacetic acid;azane is sourced from PubChem (CID 175048501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).