About 2-aminoacetic acid;methane;hydrochloride
2-aminoacetic acid;methane;hydrochloride (PubChem CID 174614167) has the molecular formula C3H10ClNO2
and a molecular weight of 127.57 g/mol. Its IUPAC name is 2-aminoacetic acid;methane;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoacetic acid;methane;hydrochloride |
| PubChem CID | 174614167 |
| Molecular Formula | C3H10ClNO2 |
| Molecular Weight | 127.57 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 2-aminoacetic acid;methane;hydrochloride |
| SMILES | C.Cl.NCC(=O)O |
| InChI | InChI=1S/C2H5NO2.CH4.ClH/c3-1-2(4)5;;/h1,3H2,(H,4,5);1H4;1H |
| InChIKey | ZABPAMGROSCJCL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.57 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminoacetic acid;methane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;methane;hydrochloride?
The IUPAC name of 2-aminoacetic acid;methane;hydrochloride (CID 174614167) is 2-aminoacetic acid;methane;hydrochloride.
What is the SMILES notation for 2-aminoacetic acid;methane;hydrochloride?
The canonical SMILES for 2-aminoacetic acid;methane;hydrochloride is C.Cl.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;methane;hydrochloride?
The InChIKey is ZABPAMGROSCJCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.CH4.ClH/c3-1-2(4)5;;/h1,3H2,(H,4,5);1H4;1H.
What are the key properties of 2-aminoacetic acid;methane;hydrochloride?
2-aminoacetic acid;methane;hydrochloride has a molecular weight of 127.57 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;methane;hydrochloride is sourced from PubChem (CID 174614167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).